C14H26O3 — CID 58645261
ethyl 2-(3-ethoxy-3-methylcyclopentyl)-2-methylpropanoate (PubChem CID 58645261) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is ethyl 2-(3-ethoxy-3-methylcyclopentyl)-2-methylpropanoate.
| Compound Name | ethyl 2-(3-ethoxy-3-methylcyclopentyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 58645261 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | ethyl 2-(3-ethoxy-3-methylcyclopentyl)-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)C1CCC(C)(OCC)C1 |
| InChI | InChI=1S/C14H26O3/c1-6-16-12(15)13(3,4)11-8-9-14(5,10-11)17-7-2/h11H,6-10H2,1-5H3 |
| InChIKey | LVFWDMHQJYQFMX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |