C13H24O2 — CID 58645311
2,2,6,6,7-pentamethyl-4,5,5a,7,8,8a-hexahydrocyclopenta[d][1,3]dioxepine (PubChem CID 58645311) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 2,2,6,6,7-pentamethyl-4,5,5a,7,8,8a-hexahydrocyclopenta[d][1,3]dioxepine.
| Compound Name | 2,2,6,6,7-pentamethyl-4,5,5a,7,8,8a-hexahydrocyclopenta[d][1,3]dioxepine |
|---|---|
| PubChem CID | 58645311 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 2,2,6,6,7-pentamethyl-4,5,5a,7,8,8a-hexahydrocyclopenta[d][1,3]dioxepine |
| SMILES | CC1CC2OC(C)(C)OCCC2C1(C)C |
| InChI | InChI=1S/C13H24O2/c1-9-8-11-10(12(9,2)3)6-7-14-13(4,5)15-11/h9-11H,6-8H2,1-5H3 |
| InChIKey | IXZJPSAUPXZHKT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |