C16H16NOY- — CID 58647027
acetyl(1,1-diphenylethyl)azanide;yttrium (PubChem CID 58647027) has the molecular formula C16H16NOY- and a molecular weight of 327.22 g/mol. Its IUPAC name is acetyl(1,1-diphenylethyl)azanide;yttrium.
| Compound Name | acetyl(1,1-diphenylethyl)azanide;yttrium |
|---|---|
| PubChem CID | 58647027 |
| Molecular Formula | C16H16NOY- |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | acetyl(1,1-diphenylethyl)azanide;yttrium |
| SMILES | CC(=O)[N-]C(C)(c1ccccc1)c1ccccc1.[Y] |
| InChI | InChI=1S/C16H17NO.Y/c1-13(18)17-16(2,14-9-5-3-6-10-14)15-11-7-4-8-12-15;/h3-12H,1-2H3,(H,17,18);/p-1 |
| InChIKey | AHALTWBWJAQWOZ-UHFFFAOYSA-M |
| XLogP | 3.87 |
| TPSA | 31.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |