C23H30F4IrNO3- — CID 58648891
1-(3-ethylpentoxy)butane-1,3-diol;2-(4-fluorobenzene-6-id-1-yl)-5-(trifluoromethyl)pyridine;iridium (PubChem CID 58648891) has the molecular formula C23H30F4IrNO3- and a molecular weight of 636.71 g/mol. Its IUPAC name is 1-(3-ethylpentoxy)butane-1,3-diol;2-(4-fluorobenzene-6-id-1-yl)-5-(trifluoromethyl)pyridine;iridium.
| Compound Name | 1-(3-ethylpentoxy)butane-1,3-diol;2-(4-fluorobenzene-6-id-1-yl)-5-(trifluoromethyl)pyridine;iridium |
|---|---|
| PubChem CID | 58648891 |
| Molecular Formula | C23H30F4IrNO3- |
| Molecular Weight | 636.71 g/mol |
| Exact Mass | 637.18 |
| IUPAC Name | 1-(3-ethylpentoxy)butane-1,3-diol;2-(4-fluorobenzene-6-id-1-yl)-5-(trifluoromethyl)pyridine;iridium |
| SMILES | CCC(CC)CCOC(O)CC(C)O.Fc1c[c-]c(-c2ccc(C(F)(F)F)cn2)cc1.[Ir] |
| InChI | InChI=1S/C12H6F4N.C11H24O3.Ir/c13-10-4-1-8(2-5-10)11-6-3-9(7-17-11)12(14,15)16;1-4-10(5-2)6-7-14-11(13)8-9(3)12;/h1,3-7H;9-13H,4-8H2,1-3H3;/q-1;; |
| InChIKey | FJMDBVAYDOTXBL-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.71 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|