C21H19F2NO2 — CID 19386253
5-[2-[5-[(E)-but-1-enyl]-1,3-dioxan-2-yl]ethynyl]-2-(3,4-difluorophenyl)pyridine (PubChem CID 19386253) has the molecular formula C21H19F2NO2 and a molecular weight of 355.38 g/mol. Its IUPAC name is 5-[2-[5-[(E)-but-1-enyl]-1,3-dioxan-2-yl]ethynyl]-2-(3,4-difluorophenyl)pyridine.
| Compound Name | 5-[2-[5-[(E)-but-1-enyl]-1,3-dioxan-2-yl]ethynyl]-2-(3,4-difluorophenyl)pyridine |
|---|---|
| PubChem CID | 19386253 |
| Molecular Formula | C21H19F2NO2 |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 5-[2-[5-[(E)-but-1-enyl]-1,3-dioxan-2-yl]ethynyl]-2-(3,4-difluorophenyl)pyridine |
| SMILES | CC/C=C/C1COC(C#Cc2ccc(-c3ccc(F)c(F)c3)nc2)OC1 |
| InChI | InChI=1S/C21H19F2NO2/c1-2-3-4-16-13-25-21(26-14-16)10-6-15-5-9-20(24-12-15)17-7-8-18(22)19(23)11-17/h3-5,7-9,11-12,16,21H,2,13-14H2,1H3/b4-3+ |
| InChIKey | OKJVDMBHJMAONV-ONEGZZNKSA-N |
| XLogP | 4.33 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|