C19H18Cl2N2O2 — CID 58649119
2-[(3S)-3-(3,4-dichlorophenyl)-1-(6-methyl-2-pyridinyl)-6-oxopiperidin-3-yl]acetaldehyde (PubChem CID 58649119) has the molecular formula C19H18Cl2N2O2 and a molecular weight of 377.27 g/mol. Its IUPAC name is 2-[(3S)-3-(3,4-dichlorophenyl)-1-(6-methyl-2-pyridinyl)-6-oxopiperidin-3-yl]acetaldehyde.
| Compound Name | 2-[(3S)-3-(3,4-dichlorophenyl)-1-(6-methyl-2-pyridinyl)-6-oxopiperidin-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 58649119 |
| Molecular Formula | C19H18Cl2N2O2 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 2-[(3S)-3-(3,4-dichlorophenyl)-1-(6-methyl-2-pyridinyl)-6-oxopiperidin-3-yl]acetaldehyde |
| SMILES | Cc1cccc(N2C[C@@](CC=O)(c3ccc(Cl)c(Cl)c3)CCC2=O)n1 |
| InChI | InChI=1S/C19H18Cl2N2O2/c1-13-3-2-4-17(22-13)23-12-19(9-10-24,8-7-18(23)25)14-5-6-15(20)16(21)11-14/h2-6,10-11H,7-9,12H2,1H3/t19-/m1/s1 |
| InChIKey | VYXLWZIVZZIUIW-LJQANCHMSA-N |
| XLogP | 4.35 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|