C20H22Cl2N2O3 — CID 58649130
(5S)-5-(3,4-dichlorophenyl)-5-(2,2-dimethoxyethyl)-1-pyridin-2-ylpiperidin-2-one (PubChem CID 58649130) has the molecular formula C20H22Cl2N2O3 and a molecular weight of 409.31 g/mol. Its IUPAC name is (5S)-5-(3,4-dichlorophenyl)-5-(2,2-dimethoxyethyl)-1-pyridin-2-ylpiperidin-2-one.
| Compound Name | (5S)-5-(3,4-dichlorophenyl)-5-(2,2-dimethoxyethyl)-1-pyridin-2-ylpiperidin-2-one |
|---|---|
| PubChem CID | 58649130 |
| Molecular Formula | C20H22Cl2N2O3 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | (5S)-5-(3,4-dichlorophenyl)-5-(2,2-dimethoxyethyl)-1-pyridin-2-ylpiperidin-2-one |
| SMILES | COC(C[C@]1(c2ccc(Cl)c(Cl)c2)CCC(=O)N(c2ccccn2)C1)OC |
| InChI | InChI=1S/C20H22Cl2N2O3/c1-26-19(27-2)12-20(14-6-7-15(21)16(22)11-14)9-8-18(25)24(13-20)17-5-3-4-10-23-17/h3-7,10-11,19H,8-9,12-13H2,1-2H3/t20-/m1/s1 |
| InChIKey | FYJCMPYZMZRQLK-HXUWFJFHSA-N |
| XLogP | 4.46 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|