C24H24N8 — CID 58652019
2-[3,5,7-tri(pyrimidin-2-yl)cyclooctyl]pyrimidine (PubChem CID 58652019) has the molecular formula C24H24N8 and a molecular weight of 424.51 g/mol. Its IUPAC name is 2-[3,5,7-tri(pyrimidin-2-yl)cyclooctyl]pyrimidine.
| Compound Name | 2-[3,5,7-tri(pyrimidin-2-yl)cyclooctyl]pyrimidine |
|---|---|
| PubChem CID | 58652019 |
| Molecular Formula | C24H24N8 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 2-[3,5,7-tri(pyrimidin-2-yl)cyclooctyl]pyrimidine |
| SMILES | c1cnc(C2CC(c3ncccn3)CC(c3ncccn3)CC(c3ncccn3)C2)nc1 |
| InChI | InChI=1S/C24H24N8/c1-5-25-21(26-6-1)17-13-18(22-27-7-2-8-28-22)15-20(24-31-11-4-12-32-24)16-19(14-17)23-29-9-3-10-30-23/h1-12,17-20H,13-16H2 |
| InChIKey | HSOWPNUVIDGYEL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |