C24H30O6S — CID 58653063
S-(hydroxymethyl) (1S,3R,6S,10R)-5,8,8,21-tetramethyl-18-oxo-2,7,9-trioxahexacyclo[11.8.0.01,3.05,12.06,10.016,21]henicosa-16,19-diene-6-carbothioate (PubChem CID 58653063) has the molecular formula C24H30O6S and a molecular weight of 446.57 g/mol. Its IUPAC name is S-(hydroxymethyl) (1S,3R,6S,10R)-5,8,8,21-tetramethyl-18-oxo-2,7,9-trioxahexacyclo[11.8.0.01,3.05,12.06,10.016,21]henicosa-16,19-diene-6-carbothioate.
| Compound Name | S-(hydroxymethyl) (1S,3R,6S,10R)-5,8,8,21-tetramethyl-18-oxo-2,7,9-trioxahexacyclo[11.8.0.01,3.05,12.06,10.016,21]henicosa-16,19-diene-6-carbothioate |
|---|---|
| PubChem CID | 58653063 |
| Molecular Formula | C24H30O6S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | S-(hydroxymethyl) (1S,3R,6S,10R)-5,8,8,21-tetramethyl-18-oxo-2,7,9-trioxahexacyclo[11.8.0.01,3.05,12.06,10.016,21]henicosa-16,19-diene-6-carbothioate |
| SMILES | CC1(C)O[C@@H]2CC3C4CCC5=CC(=O)C=CC5(C)[C@@]45O[C@@H]5CC3(C)[C@]2(C(=O)SCO)O1 |
| InChI | InChI=1S/C24H30O6S/c1-20(2)28-17-10-16-15-6-5-13-9-14(26)7-8-21(13,3)23(15)18(29-23)11-22(16,4)24(17,30-20)19(27)31-12-25/h7-9,15-18,25H,5-6,10-12H2,1-4H3/t15?,16?,17-,18-,21?,22?,23-,24+/m1/s1 |
| InChIKey | RSNPKOMYSISUNY-ISJXKSDYSA-N |
| XLogP | 3.14 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|