C23H28O6 — CID 91163136
(1S,3S,6S,10R)-5,8,8,21-tetramethyl-18-oxo-2,7,9-trioxahexacyclo[11.8.0.01,3.05,12.06,10.016,21]henicosa-15,19-diene-6-carboxylic acid (PubChem CID 91163136) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is (1S,3S,6S,10R)-5,8,8,21-tetramethyl-18-oxo-2,7,9-trioxahexacyclo[11.8.0.01,3.05,12.06,10.016,21]henicosa-15,19-diene-6-carboxylic acid.
| Compound Name | (1S,3S,6S,10R)-5,8,8,21-tetramethyl-18-oxo-2,7,9-trioxahexacyclo[11.8.0.01,3.05,12.06,10.016,21]henicosa-15,19-diene-6-carboxylic acid |
|---|---|
| PubChem CID | 91163136 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (1S,3S,6S,10R)-5,8,8,21-tetramethyl-18-oxo-2,7,9-trioxahexacyclo[11.8.0.01,3.05,12.06,10.016,21]henicosa-15,19-diene-6-carboxylic acid |
| SMILES | CC1(C)O[C@@H]2CC3C4CC=C5CC(=O)C=CC5(C)[C@@]45O[C@H]5CC3(C)[C@]2(C(=O)O)O1 |
| InChI | InChI=1S/C23H28O6/c1-19(2)27-16-10-15-14-6-5-12-9-13(24)7-8-20(12,3)22(14)17(28-22)11-21(15,4)23(16,29-19)18(25)26/h5,7-8,14-17H,6,9-11H2,1-4H3,(H,25,26)/t14?,15?,16-,17+,20?,21?,22-,23+/m1/s1 |
| InChIKey | NWVOQBAVAFUVDC-LGXIYJOSSA-N |
| XLogP | 3.01 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|