C21H15F3N4O4S — CID 58653839
[3-[5-(pyridin-3-ylmethylcarbamoyl)benzimidazol-1-yl]phenyl] trifluoromethanesulfonate (PubChem CID 58653839) has the molecular formula C21H15F3N4O4S and a molecular weight of 476.44 g/mol. Its IUPAC name is [3-[5-(pyridin-3-ylmethylcarbamoyl)benzimidazol-1-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[5-(pyridin-3-ylmethylcarbamoyl)benzimidazol-1-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58653839 |
| Molecular Formula | C21H15F3N4O4S |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | [3-[5-(pyridin-3-ylmethylcarbamoyl)benzimidazol-1-yl]phenyl] trifluoromethanesulfonate |
| SMILES | O=C(NCc1cccnc1)c1ccc2c(c1)ncn2-c1cccc(OS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C21H15F3N4O4S/c22-21(23,24)33(30,31)32-17-5-1-4-16(10-17)28-13-27-18-9-15(6-7-19(18)28)20(29)26-12-14-3-2-8-25-11-14/h1-11,13H,12H2,(H,26,29) |
| InChIKey | UFTUHLNBEKRRCU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|