C19H20N6O4S — CID 58654444
4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)ethyl]-3-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)-1,3-oxazolidin-2-one (PubChem CID 58654444) has the molecular formula C19H20N6O4S and a molecular weight of 428.47 g/mol. Its IUPAC name is 4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)ethyl]-3-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)-1,3-oxazolidin-2-one.
| Compound Name | 4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)ethyl]-3-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 58654444 |
| Molecular Formula | C19H20N6O4S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 4-[2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)ethyl]-3-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OCC(CCNCc2ccc3c(c2)OCCO3)N1c1nc(-n2ccnc2)ns1 |
| InChI | InChI=1S/C19H20N6O4S/c26-19-25(18-22-17(23-30-18)24-6-5-21-12-24)14(11-29-19)3-4-20-10-13-1-2-15-16(9-13)28-8-7-27-15/h1-2,5-6,9,12,14,20H,3-4,7-8,10-11H2 |
| InChIKey | MTBOLJZOYAVNOB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|