C32H39N3O11 — CID 58654849
methyl 2-[[(8R,8aR)-6-[(3R,4R)-4-acetyloxy-5-methyl-2-(phenylmethoxymethyl)oxan-3-yl]oxy-7-azido-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]acetate (PubChem CID 58654849) has the molecular formula C32H39N3O11 and a molecular weight of 641.67 g/mol. Its IUPAC name is methyl 2-[[(8R,8aR)-6-[(3R,4R)-4-acetyloxy-5-methyl-2-(phenylmethoxymethyl)oxan-3-yl]oxy-7-azido-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]acetate.
| Compound Name | methyl 2-[[(8R,8aR)-6-[(3R,4R)-4-acetyloxy-5-methyl-2-(phenylmethoxymethyl)oxan-3-yl]oxy-7-azido-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]acetate |
|---|---|
| PubChem CID | 58654849 |
| Molecular Formula | C32H39N3O11 |
| Molecular Weight | 641.67 g/mol |
| Exact Mass | 641.26 |
| IUPAC Name | methyl 2-[[(8R,8aR)-6-[(3R,4R)-4-acetyloxy-5-methyl-2-(phenylmethoxymethyl)oxan-3-yl]oxy-7-azido-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]acetate |
| SMILES | COC(=O)CO[C@@H]1C(N=[N+]=[N-])C(O[C@H]2C(COCc3ccccc3)OCC(C)[C@H]2OC(C)=O)OC2COC(c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C32H39N3O11/c1-19-14-40-23(16-39-15-21-10-6-4-7-11-21)28(27(19)43-20(2)36)46-32-26(34-35-33)30(41-18-25(37)38-3)29-24(44-32)17-42-31(45-29)22-12-8-5-9-13-22/h4-13,19,23-24,26-32H,14-18H2,1-3H3/t19?,23?,24?,26?,27-,28+,29+,30-,31?,32?/m1/s1 |
| InChIKey | RPBWUHGTBLCVDW-TXIPDLCBSA-N |
| XLogP | 3.63 |
| TPSA | 165.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.67 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|