C22H28N6O9 — CID 123589345
methyl 2-[[(8R,8aS)-7-azido-6-[(2R,4R)-5-azido-2-ethyl-4-hydroxyoxolan-3-yl]oxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]acetate (PubChem CID 123589345) has the molecular formula C22H28N6O9 and a molecular weight of 520.50 g/mol. Its IUPAC name is methyl 2-[[(8R,8aS)-7-azido-6-[(2R,4R)-5-azido-2-ethyl-4-hydroxyoxolan-3-yl]oxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]acetate.
| Compound Name | methyl 2-[[(8R,8aS)-7-azido-6-[(2R,4R)-5-azido-2-ethyl-4-hydroxyoxolan-3-yl]oxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]acetate |
|---|---|
| PubChem CID | 123589345 |
| Molecular Formula | C22H28N6O9 |
| Molecular Weight | 520.50 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | methyl 2-[[(8R,8aS)-7-azido-6-[(2R,4R)-5-azido-2-ethyl-4-hydroxyoxolan-3-yl]oxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]acetate |
| SMILES | CC[C@H]1OC(N=[N+]=[N-])[C@H](O)C1OC1OC2COC(c3ccccc3)O[C@H]2[C@H](OCC(=O)OC)C1N=[N+]=[N-] |
| InChI | InChI=1S/C22H28N6O9/c1-3-12-17(16(30)20(34-12)26-28-24)36-22-15(25-27-23)19(32-10-14(29)31-2)18-13(35-22)9-33-21(37-18)11-7-5-4-6-8-11/h4-8,12-13,15-22,30H,3,9-10H2,1-2H3/t12-,13?,15?,16-,17?,18-,19-,20?,21?,22?/m1/s1 |
| InChIKey | ZUACBEFILAPMKN-GDCKFMQDSA-N |
| XLogP | 2.25 |
| TPSA | 199.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|