methyl 5-(5-nitro-2-pyridinyl)thiophene-2-carboxylate

C11H8N2O4S — CID 58657120

IUPACmethyl 5-(5-nitro-2-pyridinyl)thiophene-2-carboxylate
SMILESCOC(=O)c1ccc(-c2ccc([N+](=O)[O-])cn2)s1
InChIInChI=1S/C11H8N2O4S/c1-17-11(14)10-5-4-9(18-10)8-3-2-7(6-12-8)13(15)16/h2-6H,1H3
InChIKeyFQIHCMVVTPWINL-UHFFFAOYSA-N
MW264.26 g/mol
LogP2.50
Rot. Bonds3

About methyl 5-(5-nitro-2-pyridinyl)thiophene-2-carboxylate

methyl 5-(5-nitro-2-pyridinyl)thiophene-2-carboxylate (PubChem CID 58657120) has the molecular formula C11H8N2O4S and a molecular weight of 264.26 g/mol. Its IUPAC name is methyl 5-(5-nitro-2-pyridinyl)thiophene-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-(5-nitro-2-pyridinyl)thiophene-2-carboxylate
PubChem CID58657120
Molecular FormulaC11H8N2O4S
Molecular Weight264.26 g/mol
Exact Mass264.02
IUPAC Namemethyl 5-(5-nitro-2-pyridinyl)thiophene-2-carboxylate
SMILESCOC(=O)c1ccc(-c2ccc([N+](=O)[O-])cn2)s1
InChIInChI=1S/C11H8N2O4S/c1-17-11(14)10-5-4-9(18-10)8-3-2-7(6-12-8)13(15)16/h2-6H,1H3
InChIKeyFQIHCMVVTPWINL-UHFFFAOYSA-N
XLogP2.50
TPSA82.33 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.26
LogP ≤ 52.50
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 5-(5-nitro-2-pyridinyl)thiophene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(5-nitro-2-pyridinyl)thiophene-2-carboxylate?
The IUPAC name of methyl 5-(5-nitro-2-pyridinyl)thiophene-2-carboxylate (CID 58657120) is methyl 5-(5-nitro-2-pyridinyl)thiophene-2-carboxylate.
What is the SMILES notation for methyl 5-(5-nitro-2-pyridinyl)thiophene-2-carboxylate?
The canonical SMILES for methyl 5-(5-nitro-2-pyridinyl)thiophene-2-carboxylate is COC(=O)c1ccc(-c2ccc([N+](=O)[O-])cn2)s1.
What is the InChIKey of methyl 5-(5-nitro-2-pyridinyl)thiophene-2-carboxylate?
The InChIKey is FQIHCMVVTPWINL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O4S/c1-17-11(14)10-5-4-9(18-10)8-3-2-7(6-12-8)13(15)16/h2-6H,1H3.
What are the key properties of methyl 5-(5-nitro-2-pyridinyl)thiophene-2-carboxylate?
methyl 5-(5-nitro-2-pyridinyl)thiophene-2-carboxylate has a molecular weight of 264.26 g/mol, XLogP of 2.50, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(5-nitro-2-pyridinyl)thiophene-2-carboxylate is sourced from PubChem (CID 58657120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).