C28H26N2O6 — CID 58657944
ethyl (4E)-4-(4-ethoxycarbonyl-1-methyl-2-oxo-5-phenylpyrrol-3-ylidene)-1-methyl-5-oxo-2-phenylpyrrole-3-carboxylate (PubChem CID 58657944) has the molecular formula C28H26N2O6 and a molecular weight of 486.52 g/mol. Its IUPAC name is ethyl (4E)-4-(4-ethoxycarbonyl-1-methyl-2-oxo-5-phenylpyrrol-3-ylidene)-1-methyl-5-oxo-2-phenylpyrrole-3-carboxylate.
| Compound Name | ethyl (4E)-4-(4-ethoxycarbonyl-1-methyl-2-oxo-5-phenylpyrrol-3-ylidene)-1-methyl-5-oxo-2-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 58657944 |
| Molecular Formula | C28H26N2O6 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | ethyl (4E)-4-(4-ethoxycarbonyl-1-methyl-2-oxo-5-phenylpyrrol-3-ylidene)-1-methyl-5-oxo-2-phenylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N(C)C(=O)/C1=C1/C(=O)N(C)C(c2ccccc2)=C1C(=O)OCC |
| InChI | InChI=1S/C28H26N2O6/c1-5-35-27(33)21-19(25(31)29(3)23(21)17-13-9-7-10-14-17)20-22(28(34)36-6-2)24(30(4)26(20)32)18-15-11-8-12-16-18/h7-16H,5-6H2,1-4H3/b20-19+ |
| InChIKey | WFDPARGMWVAKGV-FMQUCBEESA-N |
| XLogP | 3.18 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|