C26H30N2O — CID 58659577
(5-amino-2-methylphenyl)-[2-methyl-4-(2,3,4,5,6-pentamethylanilino)phenyl]methanone (PubChem CID 58659577) has the molecular formula C26H30N2O and a molecular weight of 386.54 g/mol. Its IUPAC name is (5-amino-2-methylphenyl)-[2-methyl-4-(2,3,4,5,6-pentamethylanilino)phenyl]methanone.
| Compound Name | (5-amino-2-methylphenyl)-[2-methyl-4-(2,3,4,5,6-pentamethylanilino)phenyl]methanone |
|---|---|
| PubChem CID | 58659577 |
| Molecular Formula | C26H30N2O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | (5-amino-2-methylphenyl)-[2-methyl-4-(2,3,4,5,6-pentamethylanilino)phenyl]methanone |
| SMILES | Cc1cc(Nc2c(C)c(C)c(C)c(C)c2C)ccc1C(=O)c1cc(N)ccc1C |
| InChI | InChI=1S/C26H30N2O/c1-14-8-9-21(27)13-24(14)26(29)23-11-10-22(12-15(23)2)28-25-19(6)17(4)16(3)18(5)20(25)7/h8-13,28H,27H2,1-7H3 |
| InChIKey | OMLRFMCVZXFJHN-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|