C22H31F3O — CID 58660410
2,2,8-trifluoro-6-(4-heptylcyclohexyl)-3,4-dihydrochromene (PubChem CID 58660410) has the molecular formula C22H31F3O and a molecular weight of 368.48 g/mol. Its IUPAC name is 2,2,8-trifluoro-6-(4-heptylcyclohexyl)-3,4-dihydrochromene.
| Compound Name | 2,2,8-trifluoro-6-(4-heptylcyclohexyl)-3,4-dihydrochromene |
|---|---|
| PubChem CID | 58660410 |
| Molecular Formula | C22H31F3O |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 2,2,8-trifluoro-6-(4-heptylcyclohexyl)-3,4-dihydrochromene |
| SMILES | CCCCCCCC1CCC(c2cc(F)c3c(c2)CCC(F)(F)O3)CC1 |
| InChI | InChI=1S/C22H31F3O/c1-2-3-4-5-6-7-16-8-10-17(11-9-16)19-14-18-12-13-22(24,25)26-21(18)20(23)15-19/h14-17H,2-13H2,1H3 |
| InChIKey | IHYVIRCFIKOAJN-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|