C36H35F2N2OP — CID 58661096
4-tert-butyl-2-[5-[[3-(4-tert-butyl-2-pyridinyl)-4-fluorophenyl]-phenylphosphoryl]-2-fluorophenyl]pyridine (PubChem CID 58661096) has the molecular formula C36H35F2N2OP and a molecular weight of 580.66 g/mol. Its IUPAC name is 4-tert-butyl-2-[5-[[3-(4-tert-butyl-2-pyridinyl)-4-fluorophenyl]-phenylphosphoryl]-2-fluorophenyl]pyridine.
| Compound Name | 4-tert-butyl-2-[5-[[3-(4-tert-butyl-2-pyridinyl)-4-fluorophenyl]-phenylphosphoryl]-2-fluorophenyl]pyridine |
|---|---|
| PubChem CID | 58661096 |
| Molecular Formula | C36H35F2N2OP |
| Molecular Weight | 580.66 g/mol |
| Exact Mass | 580.25 |
| IUPAC Name | 4-tert-butyl-2-[5-[[3-(4-tert-butyl-2-pyridinyl)-4-fluorophenyl]-phenylphosphoryl]-2-fluorophenyl]pyridine |
| SMILES | CC(C)(C)c1ccnc(-c2cc(P(=O)(c3ccccc3)c3ccc(F)c(-c4cc(C(C)(C)C)ccn4)c3)ccc2F)c1 |
| InChI | InChI=1S/C36H35F2N2OP/c1-35(2,3)24-16-18-39-33(20-24)29-22-27(12-14-31(29)37)42(41,26-10-8-7-9-11-26)28-13-15-32(38)30(23-28)34-21-25(17-19-40-34)36(4,5)6/h7-23H,1-6H3 |
| InChIKey | ZRYSQXHGBYJESQ-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.66 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|