C20H18FN — CID 162708789
2-(4-fluorophenyl)-4-(2-phenylpropan-2-yl)pyridine (PubChem CID 162708789) has the molecular formula C20H18FN and a molecular weight of 291.37 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-(2-phenylpropan-2-yl)pyridine.
| Compound Name | 2-(4-fluorophenyl)-4-(2-phenylpropan-2-yl)pyridine |
|---|---|
| PubChem CID | 162708789 |
| Molecular Formula | C20H18FN |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2-(4-fluorophenyl)-4-(2-phenylpropan-2-yl)pyridine |
| SMILES | CC(C)(c1ccccc1)c1ccnc(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H18FN/c1-20(2,16-6-4-3-5-7-16)17-12-13-22-19(14-17)15-8-10-18(21)11-9-15/h3-14H,1-2H3 |
| InChIKey | ZNYGUBNHZNZYMX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |