C15H8F11GeN — CID 169052669
[difluoro-(2-phenyl-4-pyridinyl)methyl]-tris(trifluoromethyl)germane (PubChem CID 169052669) has the molecular formula C15H8F11GeN and a molecular weight of 483.82 g/mol. Its IUPAC name is [difluoro-(2-phenyl-4-pyridinyl)methyl]-tris(trifluoromethyl)germane.
| Compound Name | [difluoro-(2-phenyl-4-pyridinyl)methyl]-tris(trifluoromethyl)germane |
|---|---|
| PubChem CID | 169052669 |
| Molecular Formula | C15H8F11GeN |
| Molecular Weight | 483.82 g/mol |
| Exact Mass | 484.97 |
| IUPAC Name | [difluoro-(2-phenyl-4-pyridinyl)methyl]-tris(trifluoromethyl)germane |
| SMILES | FC(F)(F)[Ge](C(F)(F)F)(C(F)(F)F)C(F)(F)c1ccnc(-c2ccccc2)c1 |
| InChI | InChI=1S/C15H8F11GeN/c16-12(17,27(13(18,19)20,14(21,22)23)15(24,25)26)10-6-7-28-11(8-10)9-4-2-1-3-5-9/h1-8H |
| InChIKey | SHPITYSMDYDPMD-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.82 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |