C15H10F9GeN — CID 169052705
[dideuterio-(2-phenyl-4-pyridinyl)methyl]-tris(trifluoromethyl)germane (PubChem CID 169052705) has the molecular formula C15H10F9GeN and a molecular weight of 449.86 g/mol. Its IUPAC name is [dideuterio-(2-phenyl-4-pyridinyl)methyl]-tris(trifluoromethyl)germane.
| Compound Name | [dideuterio-(2-phenyl-4-pyridinyl)methyl]-tris(trifluoromethyl)germane |
|---|---|
| PubChem CID | 169052705 |
| Molecular Formula | C15H10F9GeN |
| Molecular Weight | 449.86 g/mol |
| Exact Mass | 451.00 |
| IUPAC Name | [dideuterio-(2-phenyl-4-pyridinyl)methyl]-tris(trifluoromethyl)germane |
| SMILES | [2H]C([2H])(c1ccnc(-c2ccccc2)c1)[Ge](C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H10F9GeN/c16-13(17,18)25(14(19,20)21,15(22,23)24)9-10-6-7-26-12(8-10)11-4-2-1-3-5-11/h1-8H,9H2/i9D2 |
| InChIKey | PMJVVCZXCYXMBR-KNXIQCGSSA-N |
| XLogP | 5.58 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.86 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |