About 4-ethyl-2-phenylpyridine;fluoroform;iridium
4-ethyl-2-phenylpyridine;fluoroform;iridium (PubChem CID 174671800) has the molecular formula C14H14F3IrN
and a molecular weight of 445.48 g/mol. Its IUPAC name is 4-ethyl-2-phenylpyridine;fluoroform;iridium.
Molecular Properties
| Compound Name | 4-ethyl-2-phenylpyridine;fluoroform;iridium |
| PubChem CID | 174671800 |
| Molecular Formula | C14H14F3IrN |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 4-ethyl-2-phenylpyridine;fluoroform;iridium |
| SMILES | CCc1ccnc(-c2ccccc2)c1.FC(F)F.[Ir] |
| InChI | InChI=1S/C13H13N.CHF3.Ir/c1-2-11-8-9-14-13(10-11)12-6-4-3-5-7-12;2-1(3)4;/h3-10H,2H2,1H3;1H; |
| InChIKey | RIVDBOMXFVOZSO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethyl-2-phenylpyridine;fluoroform;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-phenylpyridine;fluoroform;iridium?
The IUPAC name of 4-ethyl-2-phenylpyridine;fluoroform;iridium (CID 174671800) is 4-ethyl-2-phenylpyridine;fluoroform;iridium.
What is the SMILES notation for 4-ethyl-2-phenylpyridine;fluoroform;iridium?
The canonical SMILES for 4-ethyl-2-phenylpyridine;fluoroform;iridium is CCc1ccnc(-c2ccccc2)c1.FC(F)F.[Ir].
What is the InChIKey of 4-ethyl-2-phenylpyridine;fluoroform;iridium?
The InChIKey is RIVDBOMXFVOZSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N.CHF3.Ir/c1-2-11-8-9-14-13(10-11)12-6-4-3-5-7-12;2-1(3)4;/h3-10H,2H2,1H3;1H;.
What are the key properties of 4-ethyl-2-phenylpyridine;fluoroform;iridium?
4-ethyl-2-phenylpyridine;fluoroform;iridium has a molecular weight of 445.48 g/mol, XLogP of 4.49, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-phenylpyridine;fluoroform;iridium is sourced from PubChem (CID 174671800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).