C9H12ClNO3S — CID 58661581
(2R)-2-amino-3-(2-chlorophenyl)propane-1-sulfonic acid (PubChem CID 58661581) has the molecular formula C9H12ClNO3S and a molecular weight of 249.72 g/mol. Its IUPAC name is (2R)-2-amino-3-(2-chlorophenyl)propane-1-sulfonic acid.
| Compound Name | (2R)-2-amino-3-(2-chlorophenyl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 58661581 |
| Molecular Formula | C9H12ClNO3S |
| Molecular Weight | 249.72 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | (2R)-2-amino-3-(2-chlorophenyl)propane-1-sulfonic acid |
| SMILES | N[C@H](Cc1ccccc1Cl)CS(=O)(=O)O |
| InChI | InChI=1S/C9H12ClNO3S/c10-9-4-2-1-3-7(9)5-8(11)6-15(12,13)14/h1-4,8H,5-6,11H2,(H,12,13,14)/t8-/m1/s1 |
| InChIKey | AYDRLVQHFVMFLK-MRVPVSSYSA-N |
| XLogP | 1.10 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.72 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|