About 5-[(3R,5R)-8,11-dioxadispiro[4.1.47.35]tetradecan-3-yl]-2-methylpentan-2-ol
5-[(3R,5R)-8,11-dioxadispiro[4.1.47.35]tetradecan-3-yl]-2-methylpentan-2-ol (PubChem CID 58661782) has the molecular formula C18H32O3
and a molecular weight of 296.45 g/mol. Its IUPAC name is 5-[(3R,5R)-8,11-dioxadispiro[4.1.47.35]tetradecan-3-yl]-2-methylpentan-2-ol.
Molecular Properties
| Compound Name | 5-[(3R,5R)-8,11-dioxadispiro[4.1.47.35]tetradecan-3-yl]-2-methylpentan-2-ol |
| PubChem CID | 58661782 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | 5-[(3R,5R)-8,11-dioxadispiro[4.1.47.35]tetradecan-3-yl]-2-methylpentan-2-ol |
| SMILES | CC(C)(O)CCC[C@@H]1CC[C@]2(CCCC3(C2)OCCO3)C1 |
| InChI | InChI=1S/C18H32O3/c1-16(2,19)7-3-5-15-6-10-17(13-15)8-4-9-18(14-17)20-11-12-21-18/h15,19H,3-14H2,1-2H3/t15-,17-/m1/s1 |
| InChIKey | FQHAONGXJNNIMQ-NVXWUHKLSA-N |
| XLogP | 4.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(3R,5R)-8,11-dioxadispiro[4.1.47.35]tetradecan-3-yl]-2-methylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3R,5R)-8,11-dioxadispiro[4.1.47.35]tetradecan-3-yl]-2-methylpentan-2-ol?
The IUPAC name of 5-[(3R,5R)-8,11-dioxadispiro[4.1.47.35]tetradecan-3-yl]-2-methylpentan-2-ol (CID 58661782) is 5-[(3R,5R)-8,11-dioxadispiro[4.1.47.35]tetradecan-3-yl]-2-methylpentan-2-ol.
What is the SMILES notation for 5-[(3R,5R)-8,11-dioxadispiro[4.1.47.35]tetradecan-3-yl]-2-methylpentan-2-ol?
The canonical SMILES for 5-[(3R,5R)-8,11-dioxadispiro[4.1.47.35]tetradecan-3-yl]-2-methylpentan-2-ol is CC(C)(O)CCC[C@@H]1CC[C@]2(CCCC3(C2)OCCO3)C1.
What is the InChIKey of 5-[(3R,5R)-8,11-dioxadispiro[4.1.47.35]tetradecan-3-yl]-2-methylpentan-2-ol?
The InChIKey is FQHAONGXJNNIMQ-NVXWUHKLSA-N. The full InChI is InChI=1S/C18H32O3/c1-16(2,19)7-3-5-15-6-10-17(13-15)8-4-9-18(14-17)20-11-12-21-18/h15,19H,3-14H2,1-2H3/t15-,17-/m1/s1.
What are the key properties of 5-[(3R,5R)-8,11-dioxadispiro[4.1.47.35]tetradecan-3-yl]-2-methylpentan-2-ol?
5-[(3R,5R)-8,11-dioxadispiro[4.1.47.35]tetradecan-3-yl]-2-methylpentan-2-ol has a molecular weight of 296.45 g/mol, XLogP of 4.03, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3R,5R)-8,11-dioxadispiro[4.1.47.35]tetradecan-3-yl]-2-methylpentan-2-ol is sourced from PubChem (CID 58661782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).