C11H13N3S — CID 58663770
N-benzyl-N,5-dimethyl-1,3,4-thiadiazol-2-amine (PubChem CID 58663770) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is N-benzyl-N,5-dimethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-benzyl-N,5-dimethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 58663770 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | N-benzyl-N,5-dimethyl-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1nnc(N(C)Cc2ccccc2)s1 |
| InChI | InChI=1S/C11H13N3S/c1-9-12-13-11(15-9)14(2)8-10-6-4-3-5-7-10/h3-7H,8H2,1-2H3 |
| InChIKey | VVIWKYMPIBUXSP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |