C11H13N3O2S2 — CID 102297761
N-benzyl-N,5-dimethyl-1,3,4-thiadiazole-2-sulfonamide (PubChem CID 102297761) has the molecular formula C11H13N3O2S2 and a molecular weight of 283.38 g/mol. Its IUPAC name is N-benzyl-N,5-dimethyl-1,3,4-thiadiazole-2-sulfonamide.
| Compound Name | N-benzyl-N,5-dimethyl-1,3,4-thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 102297761 |
| Molecular Formula | C11H13N3O2S2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | N-benzyl-N,5-dimethyl-1,3,4-thiadiazole-2-sulfonamide |
| SMILES | Cc1nnc(S(=O)(=O)N(C)Cc2ccccc2)s1 |
| InChI | InChI=1S/C11H13N3O2S2/c1-9-12-13-11(17-9)18(15,16)14(2)8-10-6-4-3-5-7-10/h3-7H,8H2,1-2H3 |
| InChIKey | YAZNCNUBEPZMEO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |