C11H16N4O2 — CID 58664373
1-(4-acetylpiperidin-1-yl)-2-(1,2,4-triazol-1-yl)ethanone (PubChem CID 58664373) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1-(4-acetylpiperidin-1-yl)-2-(1,2,4-triazol-1-yl)ethanone.
| Compound Name | 1-(4-acetylpiperidin-1-yl)-2-(1,2,4-triazol-1-yl)ethanone |
|---|---|
| PubChem CID | 58664373 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-(4-acetylpiperidin-1-yl)-2-(1,2,4-triazol-1-yl)ethanone |
| SMILES | CC(=O)C1CCN(C(=O)Cn2cncn2)CC1 |
| InChI | InChI=1S/C11H16N4O2/c1-9(16)10-2-4-14(5-3-10)11(17)6-15-8-12-7-13-15/h7-8,10H,2-6H2,1H3 |
| InChIKey | NNTAZBJDOVGPKA-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |