C34H43FN4O6S — CID 58665108
tert-butyl N-[(2S)-6-[(2-fluorophenyl)sulfonylamino]-1-[[(1S,2R)-6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]-1-oxohexan-2-yl]carbamate (PubChem CID 58665108) has the molecular formula C34H43FN4O6S and a molecular weight of 654.81 g/mol. Its IUPAC name is tert-butyl N-[(2S)-6-[(2-fluorophenyl)sulfonylamino]-1-[[(1S,2R)-6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]-1-oxohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-6-[(2-fluorophenyl)sulfonylamino]-1-[[(1S,2R)-6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 58665108 |
| Molecular Formula | C34H43FN4O6S |
| Molecular Weight | 654.81 g/mol |
| Exact Mass | 654.29 |
| IUPAC Name | tert-butyl N-[(2S)-6-[(2-fluorophenyl)sulfonylamino]-1-[[(1S,2R)-6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]-1-oxohexan-2-yl]carbamate |
| SMILES | COc1ccc2c(c1)CC[C@@H](NC(=O)[C@H](CCCCNS(=O)(=O)c1ccccc1F)NC(=O)OC(C)(C)C)[C@H]2Cc1cccnc1 |
| InChI | InChI=1S/C34H43FN4O6S/c1-34(2,3)45-33(41)39-30(12-7-8-19-37-46(42,43)31-13-6-5-11-28(31)35)32(40)38-29-17-14-24-21-25(44-4)15-16-26(24)27(29)20-23-10-9-18-36-22-23/h5-6,9-11,13,15-16,18,21-22,27,29-30,37H,7-8,12,14,17,19-20H2,1-4H3,(H,38,40)(H,39,41)/t27-,29+,30-/m0/s1 |
| InChIKey | IHZMUSADBRMHDJ-SHSRKSKBSA-N |
| XLogP | 5.03 |
| TPSA | 135.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.81 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|