C16H29Cl2NOSiZr — CID 58666125
[2,3,3a,7a-tetrahydro-1H-inden-4-yloxy(dimethyl)silyl]-tert-butylazanide;carbanide;dichlorozirconium(2+) (PubChem CID 58666125) has the molecular formula C16H29Cl2NOSiZr and a molecular weight of 441.63 g/mol. Its IUPAC name is [2,3,3a,7a-tetrahydro-1H-inden-4-yloxy(dimethyl)silyl]-tert-butylazanide;carbanide;dichlorozirconium(2+).
| Compound Name | [2,3,3a,7a-tetrahydro-1H-inden-4-yloxy(dimethyl)silyl]-tert-butylazanide;carbanide;dichlorozirconium(2+) |
|---|---|
| PubChem CID | 58666125 |
| Molecular Formula | C16H29Cl2NOSiZr |
| Molecular Weight | 441.63 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | [2,3,3a,7a-tetrahydro-1H-inden-4-yloxy(dimethyl)silyl]-tert-butylazanide;carbanide;dichlorozirconium(2+) |
| SMILES | CC(C)(C)[N-][Si](C)(C)OC1=CC=CC2CCCC12.Cl[Zr+2]Cl.[CH3-] |
| InChI | InChI=1S/C15H26NOSi.CH3.2ClH.Zr/c1-15(2,3)16-18(4,5)17-14-11-7-9-12-8-6-10-13(12)14;;;;/h7,9,11-13H,6,8,10H2,1-5H3;1H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | ADEITOVLZCRSEE-UHFFFAOYSA-L |
| XLogP | 6.57 |
| TPSA | 23.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.63 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|