C23H43B2N2O15P3 — CID 58667817
CID 58667817 (PubChem CID 58667817) has the molecular formula C23H43B2N2O15P3 and a molecular weight of 702.14 g/mol.
| Compound Name | CID 58667817 |
|---|---|
| PubChem CID | 58667817 |
| Molecular Formula | C23H43B2N2O15P3 |
| Molecular Weight | 702.14 g/mol |
| Exact Mass | 702.21 |
| IUPAC Name | — |
| SMILES | [B]C1CC(OP(=O)(O)OC)C(COP(=O)(NC(=O)CCCNC(=O)CCCCCC)OC2CC([B])OC2COP(=O)(O)OC)O1 |
| InChI | InChI=1S/C23H43B2N2O15P3/c1-4-5-6-7-9-22(28)26-11-8-10-23(29)27-43(30,37-14-18-17(13-21(25)39-18)42-45(33,34)36-3)41-16-12-20(24)40-19(16)15-38-44(31,32)35-2/h16-21H,4-15H2,1-3H3,(H,26,28)(H,31,32)(H,33,34)(H,27,29,30) |
| InChIKey | HEQBSRPRIXVOLG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 223.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.14 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|