C13H26O3S7 — CID 58670781
S-(hydroxymethylsulfanylmethylsulfanylmethyl) 3-(3-ethylsulfinylpropylsulfanylmethylsulfanylmethylsulfanyl)propanethioate (PubChem CID 58670781) has the molecular formula C13H26O3S7 and a molecular weight of 454.82 g/mol. Its IUPAC name is S-(hydroxymethylsulfanylmethylsulfanylmethyl) 3-(3-ethylsulfinylpropylsulfanylmethylsulfanylmethylsulfanyl)propanethioate.
| Compound Name | S-(hydroxymethylsulfanylmethylsulfanylmethyl) 3-(3-ethylsulfinylpropylsulfanylmethylsulfanylmethylsulfanyl)propanethioate |
|---|---|
| PubChem CID | 58670781 |
| Molecular Formula | C13H26O3S7 |
| Molecular Weight | 454.82 g/mol |
| Exact Mass | 453.99 |
| IUPAC Name | S-(hydroxymethylsulfanylmethylsulfanylmethyl) 3-(3-ethylsulfinylpropylsulfanylmethylsulfanylmethylsulfanyl)propanethioate |
| SMILES | CCS(=O)CCCSCSCSCCC(=O)SCSCSCO |
| InChI | InChI=1S/C13H26O3S7/c1-2-23(16)7-3-5-17-9-20-10-18-6-4-13(15)22-12-21-11-19-8-14/h14H,2-12H2,1H3 |
| InChIKey | VFBUVXLMWCGQIO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.82 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|