C17H34O4S9 — CID 58670968
S-[2-(ethylsulfanylmethylsulfanylmethylsulfanyl)ethyl] 3-[3-(hydroxymethylsulfanylmethylsulfanylmethylperoxy)propylsulfanylmethylsulfanylmethylsulfanyl]propanethioate (PubChem CID 58670968) has the molecular formula C17H34O4S9 and a molecular weight of 591.06 g/mol. Its IUPAC name is S-[2-(ethylsulfanylmethylsulfanylmethylsulfanyl)ethyl] 3-[3-(hydroxymethylsulfanylmethylsulfanylmethylperoxy)propylsulfanylmethylsulfanylmethylsulfanyl]propanethioate.
| Compound Name | S-[2-(ethylsulfanylmethylsulfanylmethylsulfanyl)ethyl] 3-[3-(hydroxymethylsulfanylmethylsulfanylmethylperoxy)propylsulfanylmethylsulfanylmethylsulfanyl]propanethioate |
|---|---|
| PubChem CID | 58670968 |
| Molecular Formula | C17H34O4S9 |
| Molecular Weight | 591.06 g/mol |
| Exact Mass | 589.99 |
| IUPAC Name | S-[2-(ethylsulfanylmethylsulfanylmethylsulfanyl)ethyl] 3-[3-(hydroxymethylsulfanylmethylsulfanylmethylperoxy)propylsulfanylmethylsulfanylmethylsulfanyl]propanethioate |
| SMILES | CCSCSCSCCSC(=O)CCSCSCSCCCOOCSCSCO |
| InChI | InChI=1S/C17H34O4S9/c1-2-22-12-28-15-25-8-9-30-17(19)4-7-24-14-29-13-23-6-3-5-20-21-11-27-16-26-10-18/h18H,2-16H2,1H3 |
| InChIKey | FRJMMVDYASVXDZ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 30 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.06 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|