C17H34O5S7 — CID 58671338
2-(ethylsulfanylmethylsulfanylmethylsulfanyl)ethyl 3-[3-[2-(hydroxymethylsulfanyl)ethylperoxy]propylsulfanylmethylsulfanylmethylsulfanyl]propanoate (PubChem CID 58671338) has the molecular formula C17H34O5S7 and a molecular weight of 542.92 g/mol. Its IUPAC name is 2-(ethylsulfanylmethylsulfanylmethylsulfanyl)ethyl 3-[3-[2-(hydroxymethylsulfanyl)ethylperoxy]propylsulfanylmethylsulfanylmethylsulfanyl]propanoate.
| Compound Name | 2-(ethylsulfanylmethylsulfanylmethylsulfanyl)ethyl 3-[3-[2-(hydroxymethylsulfanyl)ethylperoxy]propylsulfanylmethylsulfanylmethylsulfanyl]propanoate |
|---|---|
| PubChem CID | 58671338 |
| Molecular Formula | C17H34O5S7 |
| Molecular Weight | 542.92 g/mol |
| Exact Mass | 542.05 |
| IUPAC Name | 2-(ethylsulfanylmethylsulfanylmethylsulfanyl)ethyl 3-[3-[2-(hydroxymethylsulfanyl)ethylperoxy]propylsulfanylmethylsulfanylmethylsulfanyl]propanoate |
| SMILES | CCSCSCSCCOC(=O)CCSCSCSCCCOOCCSCO |
| InChI | InChI=1S/C17H34O5S7/c1-2-23-13-28-16-27-10-6-20-17(19)4-9-26-15-29-14-25-8-3-5-21-22-7-11-24-12-18/h18H,2-16H2,1H3 |
| InChIKey | IPOSBUFPVFGWSF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 29 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.92 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|