C20H36O10S7 — CID 59488361
2-[2-[2-[[2-(3-hydroxypropanoyloxymethylsulfanylmethylsulfanylmethylsulfanyl)acetyl]oxymethylsulfanylmethylsulfanyl]ethylperoxy]ethylsulfanylmethylsulfanyl]ethyl 3-hydroxypropanoate (PubChem CID 59488361) has the molecular formula C20H36O10S7 and a molecular weight of 660.97 g/mol. Its IUPAC name is 2-[2-[2-[[2-(3-hydroxypropanoyloxymethylsulfanylmethylsulfanylmethylsulfanyl)acetyl]oxymethylsulfanylmethylsulfanyl]ethylperoxy]ethylsulfanylmethylsulfanyl]ethyl 3-hydroxypropanoate.
| Compound Name | 2-[2-[2-[[2-(3-hydroxypropanoyloxymethylsulfanylmethylsulfanylmethylsulfanyl)acetyl]oxymethylsulfanylmethylsulfanyl]ethylperoxy]ethylsulfanylmethylsulfanyl]ethyl 3-hydroxypropanoate |
|---|---|
| PubChem CID | 59488361 |
| Molecular Formula | C20H36O10S7 |
| Molecular Weight | 660.97 g/mol |
| Exact Mass | 660.04 |
| IUPAC Name | 2-[2-[2-[[2-(3-hydroxypropanoyloxymethylsulfanylmethylsulfanylmethylsulfanyl)acetyl]oxymethylsulfanylmethylsulfanyl]ethylperoxy]ethylsulfanylmethylsulfanyl]ethyl 3-hydroxypropanoate |
| SMILES | O=C(CCO)OCCSCSCCOOCCSCSCOC(=O)CSCSCSCOC(=O)CCO |
| InChI | InChI=1S/C20H36O10S7/c21-3-1-18(23)26-5-8-31-14-32-9-6-29-30-7-10-33-15-35-13-28-20(25)11-34-16-37-17-36-12-27-19(24)2-4-22/h21-22H,1-17H2 |
| InChIKey | UXYAMCYHCOCLBV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.97 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|