C9H18O3S5 — CID 58670786
hydroxymethylsulfanylmethylsulfanylmethyl 3-(methylsulfanylmethylsulfanylmethylsulfanyl)propanoate (PubChem CID 58670786) has the molecular formula C9H18O3S5 and a molecular weight of 334.58 g/mol. Its IUPAC name is hydroxymethylsulfanylmethylsulfanylmethyl 3-(methylsulfanylmethylsulfanylmethylsulfanyl)propanoate.
| Compound Name | hydroxymethylsulfanylmethylsulfanylmethyl 3-(methylsulfanylmethylsulfanylmethylsulfanyl)propanoate |
|---|---|
| PubChem CID | 58670786 |
| Molecular Formula | C9H18O3S5 |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | hydroxymethylsulfanylmethylsulfanylmethyl 3-(methylsulfanylmethylsulfanylmethylsulfanyl)propanoate |
| SMILES | CSCSCSCCC(=O)OCSCSCO |
| InChI | InChI=1S/C9H18O3S5/c1-13-6-17-7-14-3-2-9(11)12-5-16-8-15-4-10/h10H,2-8H2,1H3 |
| InChIKey | CWLCAGDFUGIVBV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|