C11H22O3S5 — CID 58670640
2-(hydroxymethylsulfanylmethylsulfanyl)ethyl 3-(ethylsulfanylmethylsulfanylmethylsulfanyl)propanoate (PubChem CID 58670640) has the molecular formula C11H22O3S5 and a molecular weight of 362.63 g/mol. Its IUPAC name is 2-(hydroxymethylsulfanylmethylsulfanyl)ethyl 3-(ethylsulfanylmethylsulfanylmethylsulfanyl)propanoate.
| Compound Name | 2-(hydroxymethylsulfanylmethylsulfanyl)ethyl 3-(ethylsulfanylmethylsulfanylmethylsulfanyl)propanoate |
|---|---|
| PubChem CID | 58670640 |
| Molecular Formula | C11H22O3S5 |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 2-(hydroxymethylsulfanylmethylsulfanyl)ethyl 3-(ethylsulfanylmethylsulfanylmethylsulfanyl)propanoate |
| SMILES | CCSCSCSCCC(=O)OCCSCSCO |
| InChI | InChI=1S/C11H22O3S5/c1-2-15-8-19-10-16-5-3-11(13)14-4-6-17-9-18-7-12/h12H,2-10H2,1H3 |
| InChIKey | HZAFUYACGKZZIM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|