C20H40O7S7 — CID 59488288
2-(2-propylperoxyethylsulfanylmethylsulfanylmethylsulfanyl)ethyl 3-[3-(2-hydroxyethylsulfanylmethylperoxy)propylsulfanylmethylsulfanylmethylsulfanyl]propanoate (PubChem CID 59488288) has the molecular formula C20H40O7S7 and a molecular weight of 617.00 g/mol. Its IUPAC name is 2-(2-propylperoxyethylsulfanylmethylsulfanylmethylsulfanyl)ethyl 3-[3-(2-hydroxyethylsulfanylmethylperoxy)propylsulfanylmethylsulfanylmethylsulfanyl]propanoate.
| Compound Name | 2-(2-propylperoxyethylsulfanylmethylsulfanylmethylsulfanyl)ethyl 3-[3-(2-hydroxyethylsulfanylmethylperoxy)propylsulfanylmethylsulfanylmethylsulfanyl]propanoate |
|---|---|
| PubChem CID | 59488288 |
| Molecular Formula | C20H40O7S7 |
| Molecular Weight | 617.00 g/mol |
| Exact Mass | 616.08 |
| IUPAC Name | 2-(2-propylperoxyethylsulfanylmethylsulfanylmethylsulfanyl)ethyl 3-[3-(2-hydroxyethylsulfanylmethylperoxy)propylsulfanylmethylsulfanylmethylsulfanyl]propanoate |
| SMILES | CCCOOCCSCSCSCCOC(=O)CCSCSCSCCCOOCSCCO |
| InChI | InChI=1S/C20H40O7S7/c1-2-6-24-26-9-14-32-19-34-18-31-13-8-23-20(22)4-11-30-17-33-16-29-10-3-7-25-27-15-28-12-5-21/h21H,2-19H2,1H3 |
| InChIKey | DPOJIVOJJFZZJT-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.00 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|