C17H30O10S6 — CID 58670977
2-hydroxyethyl 2-[2-[[2-[[2-(2-hydroxyethoxy)-2-oxoethyl]sulfanylmethylsulfanyl]acetyl]oxymethylsulfanylmethylsulfanylmethylperoxy]ethylsulfanylmethylsulfanyl]acetate (PubChem CID 58670977) has the molecular formula C17H30O10S6 and a molecular weight of 586.82 g/mol. Its IUPAC name is 2-hydroxyethyl 2-[2-[[2-[[2-(2-hydroxyethoxy)-2-oxoethyl]sulfanylmethylsulfanyl]acetyl]oxymethylsulfanylmethylsulfanylmethylperoxy]ethylsulfanylmethylsulfanyl]acetate.
| Compound Name | 2-hydroxyethyl 2-[2-[[2-[[2-(2-hydroxyethoxy)-2-oxoethyl]sulfanylmethylsulfanyl]acetyl]oxymethylsulfanylmethylsulfanylmethylperoxy]ethylsulfanylmethylsulfanyl]acetate |
|---|---|
| PubChem CID | 58670977 |
| Molecular Formula | C17H30O10S6 |
| Molecular Weight | 586.82 g/mol |
| Exact Mass | 586.02 |
| IUPAC Name | 2-hydroxyethyl 2-[2-[[2-[[2-(2-hydroxyethoxy)-2-oxoethyl]sulfanylmethylsulfanyl]acetyl]oxymethylsulfanylmethylsulfanylmethylperoxy]ethylsulfanylmethylsulfanyl]acetate |
| SMILES | O=C(CSCSCCOOCSCSCOC(=O)CSCSCC(=O)OCCO)OCCO |
| InChI | InChI=1S/C17H30O10S6/c18-1-3-23-15(20)7-29-12-28-6-5-26-27-11-33-14-32-10-25-17(22)9-31-13-30-8-16(21)24-4-2-19/h18-19H,1-14H2 |
| InChIKey | QNNMNXSCJGNGKF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.82 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|