C10H18O6S3 — CID 87476466
2-hydroxyethyl 2-[[2-(2-hydroxyethoxy)-2-oxoethyl]sulfanylmethylsulfanylmethylsulfanyl]acetate (PubChem CID 87476466) has the molecular formula C10H18O6S3 and a molecular weight of 330.45 g/mol. Its IUPAC name is 2-hydroxyethyl 2-[[2-(2-hydroxyethoxy)-2-oxoethyl]sulfanylmethylsulfanylmethylsulfanyl]acetate.
| Compound Name | 2-hydroxyethyl 2-[[2-(2-hydroxyethoxy)-2-oxoethyl]sulfanylmethylsulfanylmethylsulfanyl]acetate |
|---|---|
| PubChem CID | 87476466 |
| Molecular Formula | C10H18O6S3 |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 2-hydroxyethyl 2-[[2-(2-hydroxyethoxy)-2-oxoethyl]sulfanylmethylsulfanylmethylsulfanyl]acetate |
| SMILES | O=C(CSCSCSCC(=O)OCCO)OCCO |
| InChI | InChI=1S/C10H18O6S3/c11-1-3-15-9(13)5-17-7-19-8-18-6-10(14)16-4-2-12/h11-12H,1-8H2 |
| InChIKey | MJUXQRKENSGPLL-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|