C7H15NO3S3 — CID 58670771
2-hydroxyethyl N-(methylsulfanylmethylsulfanylmethylsulfanylmethyl)carbamate (PubChem CID 58670771) has the molecular formula C7H15NO3S3 and a molecular weight of 257.40 g/mol. Its IUPAC name is 2-hydroxyethyl N-(methylsulfanylmethylsulfanylmethylsulfanylmethyl)carbamate.
| Compound Name | 2-hydroxyethyl N-(methylsulfanylmethylsulfanylmethylsulfanylmethyl)carbamate |
|---|---|
| PubChem CID | 58670771 |
| Molecular Formula | C7H15NO3S3 |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 2-hydroxyethyl N-(methylsulfanylmethylsulfanylmethylsulfanylmethyl)carbamate |
| SMILES | CSCSCSCNC(=O)OCCO |
| InChI | InChI=1S/C7H15NO3S3/c1-12-5-14-6-13-4-8-7(10)11-3-2-9/h9H,2-6H2,1H3,(H,8,10) |
| InChIKey | XBSDCRLAVGXGBO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|