C10H14O8S2 — CID 4282371
2-[2-[2-[2-(carboxymethylsulfanyl)acetyl]oxyethoxy]-2-oxoethyl]sulfanylacetic acid (PubChem CID 4282371) has the molecular formula C10H14O8S2 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-[2-[2-[2-(carboxymethylsulfanyl)acetyl]oxyethoxy]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[2-[2-(carboxymethylsulfanyl)acetyl]oxyethoxy]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 4282371 |
| Molecular Formula | C10H14O8S2 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 2-[2-[2-[2-(carboxymethylsulfanyl)acetyl]oxyethoxy]-2-oxoethyl]sulfanylacetic acid |
| SMILES | O=C(O)CSCC(=O)OCCOC(=O)CSCC(=O)O |
| InChI | InChI=1S/C10H14O8S2/c11-7(12)3-19-5-9(15)17-1-2-18-10(16)6-20-4-8(13)14/h1-6H2,(H,11,12)(H,13,14) |
| InChIKey | WPNGSDYGABZCPU-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|