About 2-(2-methylsulfanylacetyl)oxyethyl 2-methylsulfanylacetate
2-(2-methylsulfanylacetyl)oxyethyl 2-methylsulfanylacetate (PubChem CID 20673875) has the molecular formula C8H14O4S2
and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-(2-methylsulfanylacetyl)oxyethyl 2-methylsulfanylacetate.
Molecular Properties
| Compound Name | 2-(2-methylsulfanylacetyl)oxyethyl 2-methylsulfanylacetate |
| PubChem CID | 20673875 |
| Molecular Formula | C8H14O4S2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 2-(2-methylsulfanylacetyl)oxyethyl 2-methylsulfanylacetate |
| SMILES | CSCC(=O)OCCOC(=O)CSC |
| InChI | InChI=1S/C8H14O4S2/c1-13-5-7(9)11-3-4-12-8(10)6-14-2/h3-6H2,1-2H3 |
| InChIKey | RMKQOTKHVYWHLN-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylsulfanylacetyl)oxyethyl 2-methylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylsulfanylacetyl)oxyethyl 2-methylsulfanylacetate?
The IUPAC name of 2-(2-methylsulfanylacetyl)oxyethyl 2-methylsulfanylacetate (CID 20673875) is 2-(2-methylsulfanylacetyl)oxyethyl 2-methylsulfanylacetate.
What is the SMILES notation for 2-(2-methylsulfanylacetyl)oxyethyl 2-methylsulfanylacetate?
The canonical SMILES for 2-(2-methylsulfanylacetyl)oxyethyl 2-methylsulfanylacetate is CSCC(=O)OCCOC(=O)CSC.
What is the InChIKey of 2-(2-methylsulfanylacetyl)oxyethyl 2-methylsulfanylacetate?
The InChIKey is RMKQOTKHVYWHLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4S2/c1-13-5-7(9)11-3-4-12-8(10)6-14-2/h3-6H2,1-2H3.
What are the key properties of 2-(2-methylsulfanylacetyl)oxyethyl 2-methylsulfanylacetate?
2-(2-methylsulfanylacetyl)oxyethyl 2-methylsulfanylacetate has a molecular weight of 238.33 g/mol, XLogP of 0.80, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylsulfanylacetyl)oxyethyl 2-methylsulfanylacetate is sourced from PubChem (CID 20673875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).