C18H34O4S2 — CID 59440688
[2,9-dimethyl-9-(2-methylsulfanylacetyl)oxydecan-2-yl] 2-methylsulfanylacetate (PubChem CID 59440688) has the molecular formula C18H34O4S2 and a molecular weight of 378.60 g/mol. Its IUPAC name is [2,9-dimethyl-9-(2-methylsulfanylacetyl)oxydecan-2-yl] 2-methylsulfanylacetate.
| Compound Name | [2,9-dimethyl-9-(2-methylsulfanylacetyl)oxydecan-2-yl] 2-methylsulfanylacetate |
|---|---|
| PubChem CID | 59440688 |
| Molecular Formula | C18H34O4S2 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | [2,9-dimethyl-9-(2-methylsulfanylacetyl)oxydecan-2-yl] 2-methylsulfanylacetate |
| SMILES | CSCC(=O)OC(C)(C)CCCCCCC(C)(C)OC(=O)CSC |
| InChI | InChI=1S/C18H34O4S2/c1-17(2,21-15(19)13-23-5)11-9-7-8-10-12-18(3,4)22-16(20)14-24-6/h7-14H2,1-6H3 |
| InChIKey | WWPLARAPXYKBCN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|