C11H18N2O — CID 586729
1-(5,6-dimethylpyrazin-2-yl)-3-methylbutan-1-ol (PubChem CID 586729) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-(5,6-dimethylpyrazin-2-yl)-3-methylbutan-1-ol.
| Compound Name | 1-(5,6-dimethylpyrazin-2-yl)-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 586729 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 1-(5,6-dimethylpyrazin-2-yl)-3-methylbutan-1-ol |
| SMILES | Cc1ncc(C(O)CC(C)C)nc1C |
| InChI | InChI=1S/C11H18N2O/c1-7(2)5-11(14)10-6-12-8(3)9(4)13-10/h6-7,11,14H,5H2,1-4H3 |
| InChIKey | LOIBZCWECZQZHU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |