C14H27BrCl2SiZr — CID 58675330
(4-bromo-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-methanidyl-dimethylsilane;carbanide;dichlorozirconium(2+) (PubChem CID 58675330) has the molecular formula C14H27BrCl2SiZr and a molecular weight of 465.49 g/mol. Its IUPAC name is (4-bromo-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-methanidyl-dimethylsilane;carbanide;dichlorozirconium(2+).
| Compound Name | (4-bromo-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-methanidyl-dimethylsilane;carbanide;dichlorozirconium(2+) |
|---|---|
| PubChem CID | 58675330 |
| Molecular Formula | C14H27BrCl2SiZr |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 461.95 |
| IUPAC Name | (4-bromo-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-methanidyl-dimethylsilane;carbanide;dichlorozirconium(2+) |
| SMILES | Cl[Zr+2]Cl.[CH2-][Si](C)(C)C1C(C)CC2C(Br)CCCC21.[CH3-] |
| InChI | InChI=1S/C13H24BrSi.CH3.2ClH.Zr/c1-9-8-11-10(6-5-7-12(11)14)13(9)15(2,3)4;;;;/h9-13H,2,5-8H2,1,3-4H3;1H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | HYAMDZHYODURER-UHFFFAOYSA-L |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|