C21H36Br2Si — CID 59832556
(4-bromo-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-(4-bromo-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-dimethylsilane (PubChem CID 59832556) has the molecular formula C21H36Br2Si and a molecular weight of 476.41 g/mol. Its IUPAC name is (4-bromo-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-(4-bromo-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-dimethylsilane.
| Compound Name | (4-bromo-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-(4-bromo-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 59832556 |
| Molecular Formula | C21H36Br2Si |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | (4-bromo-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-(4-bromo-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-dimethylsilane |
| SMILES | CC1CC2C(Br)CCCC2C1[Si](C)(C)C1CCC2C(Br)CCCC21 |
| InChI | InChI=1S/C21H36Br2Si/c1-13-12-17-16(7-5-9-19(17)23)21(13)24(2,3)20-11-10-14-15(20)6-4-8-18(14)22/h13-21H,4-12H2,1-3H3 |
| InChIKey | PPVHQXIAHHKYTI-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|