C23H45BrSi2 — CID 153426843
(4-bromo-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-[[3-(2,2-dimethylpropyl)cyclopentyl]-dimethylsilyl]-dimethylsilane (PubChem CID 153426843) has the molecular formula C23H45BrSi2 and a molecular weight of 457.69 g/mol. Its IUPAC name is (4-bromo-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-[[3-(2,2-dimethylpropyl)cyclopentyl]-dimethylsilyl]-dimethylsilane.
| Compound Name | (4-bromo-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-[[3-(2,2-dimethylpropyl)cyclopentyl]-dimethylsilyl]-dimethylsilane |
|---|---|
| PubChem CID | 153426843 |
| Molecular Formula | C23H45BrSi2 |
| Molecular Weight | 457.69 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | (4-bromo-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-[[3-(2,2-dimethylpropyl)cyclopentyl]-dimethylsilyl]-dimethylsilane |
| SMILES | CC(C)(C)CC1CCC([Si](C)(C)[Si](C)(C)C2CCC3C(Br)CCCC32)C1 |
| InChI | InChI=1S/C23H45BrSi2/c1-23(2,3)16-17-11-12-18(15-17)25(4,5)26(6,7)22-14-13-19-20(22)9-8-10-21(19)24/h17-22H,8-16H2,1-7H3 |
| InChIKey | GPFBNASTROSFKK-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.69 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|