C19H14IrN3O3S- — CID 58675918
iridium;2-phenylquinoline;pyrimidine-4-sulfonic acid (PubChem CID 58675918) has the molecular formula C19H14IrN3O3S- and a molecular weight of 556.62 g/mol. Its IUPAC name is iridium;2-phenylquinoline;pyrimidine-4-sulfonic acid.
| Compound Name | iridium;2-phenylquinoline;pyrimidine-4-sulfonic acid |
|---|---|
| PubChem CID | 58675918 |
| Molecular Formula | C19H14IrN3O3S- |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 557.04 |
| IUPAC Name | iridium;2-phenylquinoline;pyrimidine-4-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccncn1.[Ir].[c-]1ccccc1-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C15H10N.C4H4N2O3S.Ir/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15;7-10(8,9)4-1-2-5-3-6-4;/h1-6,8-11H;1-3H,(H,7,8,9);/q-1;; |
| InChIKey | UCSUQEPRCQSJBV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|