C13H15N5O4S — CID 58678288
2-amino-3-[3-[[1-(carboxymethyl)tetrazol-5-yl]sulfanylmethyl]phenyl]propanoic acid (PubChem CID 58678288) has the molecular formula C13H15N5O4S and a molecular weight of 337.36 g/mol. Its IUPAC name is 2-amino-3-[3-[[1-(carboxymethyl)tetrazol-5-yl]sulfanylmethyl]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[3-[[1-(carboxymethyl)tetrazol-5-yl]sulfanylmethyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 58678288 |
| Molecular Formula | C13H15N5O4S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 2-amino-3-[3-[[1-(carboxymethyl)tetrazol-5-yl]sulfanylmethyl]phenyl]propanoic acid |
| SMILES | NC(Cc1cccc(CSc2nnnn2CC(=O)O)c1)C(=O)O |
| InChI | InChI=1S/C13H15N5O4S/c14-10(12(21)22)5-8-2-1-3-9(4-8)7-23-13-15-16-17-18(13)6-11(19)20/h1-4,10H,5-7,14H2,(H,19,20)(H,21,22) |
| InChIKey | VVOMJLVTQODCBG-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 144.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |